CAS
94149-28-7 Purity
---
94149-28-7 Purity
---
![1H-Pyrazole-3-carboxylic acid,1-[4-[(4-amino-9,10-dihydro-9,10-dioxo-3-sulfo-1-anthracenyl)amino]-3-sulfophenyl]-4,5-dihydro-5-oxo-4-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]azo]-,3-methyl ester,sod](https://resource.alfa-chemistry.com/structure/94157-78-5.gif)
![2-Anthracenesulfonic acid,1-amino-4-[[3-[[4-chloro-6-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]amino]-1,3,5-triazin-2-yl]amino]-2,4,6-trimethyl-5-sulfophenyl]amino]-9,10-dihydro-9,10-dioxo-,potassium](https://resource.alfa-chemistry.com/structure/94157-80-9.gif)
Inquiry Basket
3,5,8-Trioxa-4-phosphabicyclo[5.1.0]octane
CAS
941571-22-8
Catalog Number
ACM941571228
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3,5,8-trioxa-4-phosphabicyclo[5.1.0]octane.
What is the molecular formula of the compound?
The molecular formula of the compound is C4H7O3P.
What is the molecular weight of the compound?
The molecular weight of the compound is 134.07 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C4H7O3P/c1-3-4(7-3)2-6-8-5-1/h3-4,8H,1-2H2.
What is the InChIKey of the compound?
The InChIKey of the compound is XYPNUXHEPRSGLW-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1C2C(O2)COPO1.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -0.5.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
What is the topological polar surface area (TPSA) of the compound?
The topological polar surface area (TPSA) of the compound is 31.2.
Recommended Products
![N,N,N-Trimethyl-4-[[4-[(4-nitrophenyl)azo]phenyl]amino]anilinium methyl sulfate](https://resource.alfa-chemistry.com/structure/94157-76-3.gif)
CAS
94157-76-3 Purity
96%
94157-76-3 Purity
96%
