CAS
94135-80-5 Purity
---
94135-80-5 Purity
---
![1-Decyl 2-[[1-(2-chloro-5-sulfophenyl)-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-4-yl]azo]benzoate](https://resource.alfa-chemistry.com/structure/94135-83-8.gif)
Inquiry Basket
1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide
CAS
94135-90-7
Catalog Number
ACM94135907
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The molecular formula is C9H19Br2N.
What is the molecular weight of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The molecular weight is 301.06 g/mol.
What is the IUPAC name of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The IUPAC name is 1-(3-bromopropyl)-2,5-dimethylpyrrolidin-1-ium;bromide.
What is the InChIKey of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The InChIKey is VBJPHSXINZTGAA-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The canonical SMILES representation is CC1CCC([NH+]1CCCBr)C.[Br-].
What is the CAS number of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The CAS number is 94135-90-7.
How many hydrogen bond donor counts are there in 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
There is 1 hydrogen bond donor count.
What is the exact mass of 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
The exact mass is 300.98638 g/mol.
How many rotatable bond counts are there in 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide?
There are 3 rotatable bond counts.
Is 1-(3-Bromopropyl)-2,5-dimethylpyrrolidinium bromide a canonicalized compound?
Yes, the compound is canonicalized.
Recommended Products
![3-[p-(Hexyloxy)phenyl]propionic anhydride](https://resource.alfa-chemistry.com/structure/94135-92-9.gif)
