What is the molecular formula of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The molecular formula is C19H11N3O5S.
What is the molecular weight of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The molecular weight is 393.4 g/mol.
What is the IUPAC Name of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The IUPAC Name is 3,8-dinitro-6-phenylbenzo[b][1,4]benzothiazepine 11-oxide.
What is the InChI of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The InChI is InChI=1S/C19H11N3O5S/c23-21(24)13-6-8-17-15(10-13)19(12-4-2-1-3-5-12)20-16-11-14(22(25)26)7-9-18(16)28(17)27/h1-11H.
What is the InChIKey of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The InChIKey is CQRMCOMDICABOL-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The Canonical SMILES is C1=CC=C(C=C1)C2=NC3=C(C=CC(=C3)[N+](=O)[O-])S(=O)C4=C2C=C(C=C4)[N+](=O)[O-].
What is the CAS number of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The CAS number is 94113-52-7.
What is the European Community (EC) Number of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The EC Number is 302-586-6.
What is the XLogP3-AA value of 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
The XLogP3-AA value is 3.5.
How many hydrogen bond acceptors are there in 2,8-Dinitro-11-phenyldibenzo[b,f][1,4]thiazepine 5-oxide?
There are 7 hydrogen bond acceptors.