What is the molecular formula of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The molecular formula is C11H16Cl2N2O2.
What is the synonym for (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The synonym is 94110-08-4.
What is the molecular weight of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The molecular weight is 279.16 g/mol.
What is the parent compound of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The parent compound is Clormecaine.
What are the component compounds of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The component compounds are Hydrochloric Acid and Clormecaine.
What is the IUPAC name of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The IUPAC name is 2-(3-amino-4-chlorobenzoyl)oxyethyl-dimethylazanium;chloride.
What is the InChI of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The InChI is InChI=1S/C11H15ClN2O2.ClH/c1-14(2)5-6-16-11(15)8-3-4-9(12)10(13)7-8;/h3-4,7H,5-6,13H2,1-2H3;1H.
What is the InChIKey of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The InChIKey is ORTUJXQCDMPHBM-UHFFFAOYSA-N.
What is the canonical SMILES of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The canonical SMILES is C[NH+](C)CCOC(=O)C1=CC(=C(C=C1)Cl)N.[Cl-].
What is the CAS number of (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride?
The CAS number is 94110-08-4.