94107-50-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H15ClN4O3.
The molecular weight of the compound is 262.69 g/mol.
Some synonyms for the compound include Nimorazole hydrochloride and 4-[2-(5-NITRO-1H-IMIDAZOLE-1-YL)ETHYL]MORPHOLINE MONOHYDROCHLORIDE.
The IUPAC name of the compound is 4-[2-(5-nitroimidazol-1-yl)ethyl]morpholine;hydrochloride.
The InChI of the compound is InChI=1S/C9H14N4O3.ClH/c14-13(15)9-7-10-8-12(9)2-1-11-3-5-16-6-4-11;/h7-8H,1-6H2;1H
The InChIKey of the compound is YNZSADJOMNVVST-UHFFFAOYSA-N.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 76.1 Å.
Yes, the compound is canonicalized according to PubChem.