94088-00-3 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C22H20Cl2O10.
The molecular weight of the compound is 515.3 g/mol.
The IUPAC name of the compound is bis[2-(2-methylprop-2-enoyloxy)ethyl] 4,6-dicarbonochloridoylbenzene-1,3-dicarboxylate.
The InChI of the compound is InChI=1S/C22H20Cl2O10/c1-11(2)19(27)31-5-7-33-21(29)15-10-16(14(18(24)26)9-13(15)17(23)25)22(30)34-8-6-32-20(28)12(3)4/h9-10H,1,3,5-8H2,2,4H3.
The InChIKey of the compound is HHADMXONRFLIKP-UHFFFAOYSA-N.
The compound has 10 hydrogen bond acceptor count.
The compound has 16 rotatable bond count.
The exact mass of the compound is 514.0433522 g/mol.
The topological polar surface area of the compound is 139 ㎡.
Yes, the compound is canonicalized.