What is the molecular formula of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The molecular formula is C9H20BrNOS.
What is the molecular weight of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The molecular weight is 270.23 g/mol.
What is the IUPAC name of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The IUPAC name is 2-butanoylsulfanylethyl(trimethyl)azanium;bromide.
What is the InChIKey of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The InChIKey is JLFDGMDQNMQCGF-UHFFFAOYSA-M.
What is the Canonical SMILES of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The Canonical SMILES is CCCC(=O)SCC[N+](C)(C)C.[Br-].
What is the CAS number of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The CAS number is 94088-03-6.
How many hydrogen bond donor counts does [2-(Butyrylthio)ethyl]trimethylammonium bromide have?
It has 0 hydrogen bond donor count.
What is the exact mass of [2-(Butyrylthio)ethyl]trimethylammonium bromide?
The exact mass is 269.04490 g/mol.
How many rotatable bond counts does [2-(Butyrylthio)ethyl]trimethylammonium bromide have?
It has 6 rotatable bond counts.
Is [2-(Butyrylthio)ethyl]trimethylammonium bromide in canonicalized form?
Yes, it is in canonicalized form.