94087-22-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H8N2O2S.
The molecular weight of the compound is 208.24 g/mol.
The IUPAC name of the compound is 2-(1,2-benzothiazol-3-yloxy)acetamide.
The InChI of the compound is InChI=1S/C9H8N2O2S/c10-8(12)5-13-9-6-3-1-2-4-7(6)14-11-9/h1-4H,5H2,(H2,10,12).
The InChIKey of the compound is RVOTWSQZXVMKPD-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C2C(=C1)C(=NS2)OCC(=O)N.
The CAS number of the compound is 94087-28-2.
The XLogP3-AA value of the compound is 1.6.
The compound has 1 hydrogen bond donor count.
Yes, the compound is canonicalized.