What is the molecular formula of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The molecular formula is C13H10KNO4.
What is the molecular weight of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The molecular weight is 283.32 g/mol.
When was Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate created?
It was created on February 5, 2008.
What is the IUPAC name of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The IUPAC name is potassium;5-acetamido-1-hydroxynaphthalene-2-carboxylate.
What is the InChI of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The InChI is InChI=1S/C13H11NO4.K/c1-7(15)14-11-4-2-3-9-8(11)5-6-10(12(9)16)13(17)18;/h2-6,16H,1H3,(H,14,15)(H,17,18);/q;+1/p-1.
What is the Canonical SMILES of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The Canonical SMILES is CC(=O)NC1=CC=CC2=C1C=CC(=C2O)C(=O)[O-].[K+].
What is the CAS number of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The CAS number is 94030-92-9.
How many hydrogen bond donor counts does Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate have?
It has 2 hydrogen bond donor counts.
What is the exact mass of Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
The exact mass is 283.02468929 g/mol.
Is the compound canonicalized for Potassium 5-(acetylamino)-1-hydroxy-2-naphthoate?
Yes, the compound is canonicalized.