94021-93-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H18O2.
The molecular weight of the compound is 194.27 g/mol.
The IUPAC name of the compound is 1-(4-prop-1-en-2-ylcyclohexen-1-yl)ethyl formate.
The Canonical SMILES of the compound is CC(C1=CCC(CC1)C(=C)C)OC=O.
The InChIKey of the compound is UODVCNJOOYRCHL-UHFFFAOYSA-N.
The CAS number of the compound is 94021-98-4.
The compound has 2 hydrogen bond acceptors.
The compound has 4 rotatable bonds.
The exact mass of the compound is 194.130679813 g/mol.
Yes, the compound is canonicalized.