93982-20-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Methoxyanilinium nitrate is C7H10N2O4.
The molecular weight of 2-Methoxyanilinium nitrate is 186.17 g/mol.
The IUPAC name of 2-Methoxyanilinium nitrate is (2-methoxyphenyl)azanium;nitrate.
The InChIKey of 2-Methoxyanilinium nitrate is ISFKJMJAVHYERV-UHFFFAOYSA-O.
The Canonical SMILES of 2-Methoxyanilinium nitrate is COC1=CC=CC=C1[NH3+].[N+](=O)([O-])[O-].
The CAS number of 2-Methoxyanilinium nitrate is 93982-25-3.
There is 1 hydrogen bond donor count in 2-Methoxyanilinium nitrate.
There are 4 hydrogen bond acceptor counts in 2-Methoxyanilinium nitrate.
The exact mass of 2-Methoxyanilinium nitrate is 186.06405680 g/mol.
Yes, the compound is canonicalized.