CAS
939759-25-8 Purity
97%
939759-25-8 Purity
97%
Inquiry Basket
1-Pyridin-2-ylmethyl-1,2,3,4-tetrahydro-quinoxaline trihydrochloride
CAS
939760-24-4
Catalog Number
ACM939760244
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular weight of 1-Pyridin-2-ylmethyl-1,2,3,4-tetrahydro-quinoxaline trihydrochloride?
The molecular weight is 334.7 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 4-(pyridin-2-ylmethyl)-2,3-dihydro-1H-quinoxaline;trihydrochloride.
What is the InChI of the compound?
The InChI is InChI=1S/C14H15N3.3ClH/c1-2-7-14-13(6-1)16-9-10-17(14)11-12-5-3-4-8-15-12;;;/h1-8,16H,9-11H2;3*1H.
What is the canonical SMILES of the compound?
The canonical SMILES is C1CN(C2=CC=CC=C2N1)CC3=CC=CC=N3.Cl.Cl.Cl.
What is the hydrogen bond donor count?
The hydrogen bond donor count is 4.
What is the hydrogen bond acceptor count?
The hydrogen bond acceptor count is 3.
How many rotatable bonds are present in the compound?
There are 2 rotatable bonds in the compound.
What is the exact mass of the compound?
The exact mass is 333.056631 g/mol.
What is the topological polar surface area of the compound?
The topological polar surface area is 28.2?2.
How many heavy atoms are present in the compound?
There are 20 heavy atoms in the compound.
Recommended Products
CAS
939760-20-0 Purity
---
939760-20-0 Purity
---
CAS
939760-28-8 Purity
---
939760-28-8 Purity
---
![[2-Amino-2-(4-nitro-phenyl)-ethyl]-carbamic acid tert-butyl ester](https://resource.alfa-chemistry.com/structure/939760-51-7.gif)
CAS
939760-51-7 Purity
---
939760-51-7 Purity
---
