93966-61-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C23H26N2O.
The synonyms for the compound include 93966-68-8 Dimethyl(4-((4-(dimethylamino)phenyl)benzylidene)-2,5-cyclohexadien-1-ylidene)ammonium hydroxide and ZB3Z3WF9UT DIMETHYL[4-[[4-(DIMETHYLAMINO)PHENYL]BENZYLIDENE]-2,5-CYCLOHEXADIEN-1-YLIDENE]AMMONIUM HYDROXIDE.
The molecular weight of the compound is 346.5 g/mol.
The InChI of the compound is InChI=1S/C23H25N2.H2O/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H2/q+1;/p-1
The compound has 1 hydrogen bond donor count.
The heavy atom count of the compound is 26.
Yes, the compound is canonicalized.
The topological polar surface area of the compound is 7.2 Å2.
The compound has 3 rotatable bond counts.
No, the compound does not have any defined atom stereocenter count.