939-55-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 9926593.
The molecular formula of the compound is C20H18FNO.
Some synonyms of the compound include 93957-50-7 and (E)-3-(3-(4-Fluorophenyl)-1-isopropyl-1H-indol-2-yl)acrylaldehyde.
The molecular weight of the compound is 307.4 g/mol.
The IUPAC name of the compound is (E)-3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enal.
The InChIKey of the compound is DVWHSTKQJBIYCK-VMPITWQZSA-N.
The canonical SMILES of the compound is CC(C)N1C2=CC=CC=C2C(=C1C=CC=O)C3=CC=C(C=C3)F.
The CAS number of the compound is 93957-50-7.
The XLogP3-AA value of the compound is 4.4.
The compound has 2 hydrogen bond acceptor counts.