What is the molecular formula of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The molecular formula is C15H20ClNOS.
What is the molecular weight of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The molecular weight is 297.8 g/mol.
What is the IUPAC name of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The IUPAC name is dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride.
What is the InChI of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The InChI is InChI=1S/C15H20NOS.ClH/c1-16(2,13-15-9-6-12-18-15)10-11-17-14-7-4-3-5-8-14;/h3-9,12H,10-11,13H2,1-2H3;1H/q+1;/p-1.
What is the Canonical SMILES of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The Canonical SMILES is C[N+](C)(CCOC1=CC=CC=C1)CC2=CC=CS2.[Cl-].
What is the CAS number of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The CAS number is 93942-37-1.
What is the European Community (EC) Number of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The EC Number is 300-589-7.
How many hydrogen bond acceptor counts does Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Dimethyl(2-phenoxyethyl)(2-thienylmethyl)ammonium chloride?
The topological polar surface area is 37.5 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.