What is the molecular formula of [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
The molecular formula is C15H22ClNO2.
When was [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride created?
It was created on December 5, 2007.
What is the IUPAC Name of [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
The IUPAC Name is benzyl-dimethyl-(1-prop-2-enoyloxypropan-2-yl)azanium; chloride.
What is the InChIKey of [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
The InChIKey is DWNMRHBGZATFST-UHFFFAOYSA-M.
What is the Canonical SMILES of [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
The Canonical SMILES is CC(COC(=O)C=C)[N+](C)(C)CC1=CC=CC=C1.[Cl-].
What is the CAS number of [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
The CAS number is 93941-91-4.
What is the molecular weight of [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
The molecular weight is 283.79 g/mol.
How many hydrogen bond acceptors are in [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
There are 3 hydrogen bond acceptors.
How many rotatable bond counts are in [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
There are 7 rotatable bond counts.
Is the compound canonicalized for [2-(Acryloyloxy)-1-methylethyl]benzyldimethylammonium chloride?
Yes, the compound is canonicalized.