93919-51-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C17H37N3O3.
The compound was created in 2009-08-20 and last modified on 2023-12-30.
The IUPAC name of the compound is [3-[2-(2-aminoethylamino)ethylamino]-2-hydroxypropyl] 7,7-dimethyloctanoate.
The InChIKey of the compound is IVWNWZQVYIWMRA-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)(C)CCCCCC(=O)OCC(CNCCNCCN)O.
The CAS number of the compound is 93919-60-9.
The molecular weight of the compound is 331.5 g/mol.
There are 4 hydrogen bond donor counts in the compound.
There are 6 hydrogen bond acceptor counts in the compound.
Yes, the compound is canonicalized.