CAS
938-97-6 Purity
97%
938-97-6 Purity
97%
![Sodium 4-[(4-amino-9,10-dihydro-3-methyl-9,10-dioxo-1-anthryl)amino]toluene-2-sulfonate](https://resource.alfa-chemistry.com/structure/93904-39-3.gif)
![Sodium 2-[[3-[(8-acetamido-2-hydroxy-1-naphthyl)azo]-4-hydroxyphenyl]sulfonyl]ethyl sulfate](https://resource.alfa-chemistry.com/structure/93904-45-1.gif)
Inquiry Basket
Propanamide,2-(acetylmethylamino)-N,N,2-trimethyl-
CAS
939027-17-5
Catalog Number
ACM939027175
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound with PubChem CID 45119608?
The IUPAC name of the compound is 2-[acetyl(methyl)amino]-N,N,2-trimethylpropanamide.
What is the molecular formula of the compound with PubChem CID 45119608?
The molecular formula of the compound is C9H18N2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 186.25 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H18N2O2/c1-7(12)11(6)9(2,3)8(13)10(4)5/h1-6H3.
What is the InChIKey of the compound?
The InChIKey of the compound is XYWONGDMCYSCTA-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(=O)N(C)C(C)(C)C(=O)N(C)C.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -0.2.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Recommended Products
![Diethyl 2-acetamido-2-[(4-methoxy-3-methyl-phenyl)methyl]propanedioate](https://resource.alfa-chemistry.com/structure/93902-19-3.gif)
CAS
93902-19-3 Purity
96%
93902-19-3 Purity
96%
