93893-70-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is C15H18ClN.
The molecular weight of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is 247.76 g/mol.
The IUPAC name of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is 1-benzyl-5-ethyl-2-methylpyridin-1-ium; chloride.
The Canonical SMILES representation of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is CCC1=C[N+](=C(C=C1)C)CC2=CC=CC=C2.[Cl-].
The InChIKey of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is GUEPTLJJMZGRNU-UHFFFAOYSA-M.
The CAS number of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is 93893-74-4.
There are 0 hydrogen bond donor counts present in 1-Benzyl-5-ethyl-2-methylpyridinium chloride.
The exact mass of 1-Benzyl-5-ethyl-2-methylpyridinium chloride is 247.1127773 g/mol.
There are 3 rotatable bond counts present in 1-Benzyl-5-ethyl-2-methylpyridinium chloride.
Yes, the compound is canonicalized for 1-Benzyl-5-ethyl-2-methylpyridinium chloride.