93856-90-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H11Cl3N2O5.
The molecular weight of the compound is 369.6 g/mol.
The IUPAC Name of the compound is 2,3,3-trichloro-N-[1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]prop-2-enamide.
The Canonical SMILES of the compound is C1=CC(=CC=C1C(C(CO)NC(=O)C(=C(Cl)Cl)Cl)O)[N+](=O)[O-].
The InChIKey of the compound is BYMMCVVSJVRBBG-UHFFFAOYSA-N.
The compound has 3 hydrogen bond donor counts.
The exact mass of the compound is 367.973355 g/mol.
The topological polar surface area of the compound is 115 Ų.
The compound has 5 rotatable bond counts.
Yes, the compound is canonicalized according to PubChem (release 2021.10.14).