938458-82-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H10BrNO.
The molecular weight of the compound is 192.05 g/mol.
The IUPAC name of the compound is 5-(bromomethyl)-3-ethyl-4,5-dihydro-1,2-oxazole.
The InChI of the compound is InChI=1S/C6H10BrNO/c1-2-5-3-6(4-7)9-8-5/h6H,2-4H2,1H3.
The InChIKey of the compound is AVZKDSYPBXYOLW-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCC1=NOC(C1)CBr.
The CAS number of the compound is 938458-87-8.
The XLogP3-AA value of the compound is 1.4.
The compound has 0 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.