93841-16-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C21H27NO7S.
The molecular weight is 437.5 g/mol.
Some synonyms are 4-(3-Carboxy-2-methyl-3,3-diphenylpropyl)morpholinium hydrogen sulphate and AKOS030547284.
The IUPAC name is hydrogen sulfate;3-methyl-4-morpholin-4-ium-4-yl-2,2-diphenylbutanoic acid.
The Canonical SMILES is CC(C[NH+]1CCOCC1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)O.OS(=O)(=O)[O-].
The CAS number is 93841-21-5.
The compound has 3 hydrogen bond donor counts.
The topological polar surface area is 137 2.
The compound has 6 rotatable bond counts.
Yes, the compound is canonicalized.