93840-85-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C14H22O.
The molecular weight of the compound is 206.32 g/mol.
The IUPAC name of the compound is (E)-6-(4-methylcyclohex-3-en-1-yl)hept-4-enal.
The InChI of the compound is InChI=1S/C14H22O/c1-12-7-9-14(10-8-12)13(2)6-4-3-5-11-15/h4,6-7,11,13-14H,3,5,8-10H2,1-2H3/b6-4+.
The InChIKey of the compound is MAFITFSDTGHHDL-GQCTYLIASA-N.
The canonical SMILES of the compound is CC1=CCC(CC1)C(C)C=CCCC=O.
The isomeric SMILES of the compound is CC1=CCC(CC1)C(C)/C=C/CCC=O.
The CAS number of the compound is 93840-88-1.
The EC number of the compound is 298-955-3.
Yes, the compound is canonicalized.