93840-72-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H18O.
The synonyms of the compound are 4-(2,5-Dimethylcyclohexylidene)-2-butenal, EINECS 298-943-8, and 93840-77-8.
The molecular weight of the compound is 178.27 g/mol.
The IUPAC name of the compound is (E,4E)-4-(2,5-dimethylcyclohexylidene)but-2-enal.
The InChI of the compound is InChI=1S/C12H18O/c1-10-6-7-11(2)12(9-10)5-3-4-8-13/h3-5,8,10-11H,6-7,9H2,1-2H3/b4-3+,12-5+.
The InChIKey of the compound is GJCPNEBGQGWASY-ZDHPXMGNSA-N.
The canonical SMILES of the compound is CC1CCC(C(=CC=CC=O)C1)C.
The isomeric SMILES of the compound is CC1CCC(/C(=C/C=C/C=O)/C1)C.
The CAS number of the compound is 93840-77-8.
The EC number of the compound is 298-943-8.