What is the molecular formula of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The molecular formula is C6H12NaO9P.
What is the molecular weight of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The molecular weight is 282.12 g/mol.
What is the IUPAC name of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The IUPAC name is sodium;(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phosphonooxyoxan-3-olate.
What is the InChIKey of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The InChIKey is BFHRXGJIQBHJGH-WNFIKIDCSA-N.
What is the Canonical SMILES of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The Canonical SMILES is C(C1C(C(C(C(O1)OP(=O)(O)O)[O-])O)O)O.[Na+].
What is the CAS number of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The CAS number is 93839-96-4.
How many hydrogen bond donor counts does Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt have?
It has 5 hydrogen bond donor counts.
What is the exact mass of Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt?
The exact mass is 282.01166324 g/mol.
How many defined atom stereocenter counts does Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt have?
It has 5 defined atom stereocenter counts.
Is Beta-D-glucopyranose, 1-(dihydrogen phosphate), monosodium salt a canonicalized compound?
Yes, it is a canonicalized compound.