93839-64-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H20N2O.
The molecular weight of the compound is 220.31 g/mol.
The IUPAC name of the compound is 4-[(2-aminophenyl)methylamino]cyclohexan-1-ol.
The InChIKey of the compound is UERRZQCPQRIPHN-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1CC(CCC1NCC2=CC=CC=C2N)O.
The CAS number of the compound is 93839-70-4.
The compound has 3 hydrogen bond donor counts.
The XLogP3-AA value of the compound is 1.3.
The topological polar surface area of the compound is 58.3 Ų.
Yes, the compound is canonicalized.