93839-16-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C13H16N2O2S.
The synonyms of the compound are 93839-23-7, EINECS 298-793-3, and 3-ALLYL-5-[(1-METHYLPYRROLIDIN-2-YLIDENE)ETHYLIDENE]-2-THIOXOOXAZOLIDIN-4-ONE.
The molecular weight of the compound is 264.35 g/mol.
The IUPAC name of the compound is (5E)-5-[(2Z)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-oxazolidin-4-one.
The InChI of the compound is InChI=1S/C13H16N2O2S/c1-3-8-15-12(16)11(17-13(15)18)7-6-10-5-4-9-14(10)2/h3,6-7H,1,4-5,8-9H2,2H3/b10-6-,11-7+.
The InChIKey of the compound is MIMXHVDWSFTTPH-NAKBGQTNSA-N.
The canonical SMILES of the compound is CN1CCCC1=CC=C2C(=O)N(C(=S)O2)CC=C.
The isomeric SMILES of the compound is CN\1CCC/C1=C/C=C/2\C(=O)N(C(=S)O2)CC=C.
The XLogP3-AA value of the compound is 2.4.
The hydrogen bond donor count of the compound is 0.