What is the molecular formula of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The molecular formula is C9H13NNa2O5S.
What are the synonyms of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The synonyms are EINECS 298-573-7 and 93805-88-0.
What is the molecular weight of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The molecular weight is 293.25 g/mol.
What is the IUPAC name of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The IUPAC name is disodium;2-(3-carboxylatopropanoylamino)-4-methylsulfanylbutanoate.
What is the InChI of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The InChI is InChI=1S/C9H15NO5S.2Na/c1-16-5-4-6(9(14)15)10-7(11)2-3-8(12)13;;/h6H,2-5H2,1H3,(H,10,11)(H,12,13)(H,14,15);;/q;2*+1/p-2.
What is the InChIKey of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The InChIKey is ZDWMEVTVSSZLAW-UHFFFAOYSA-L.
What is the canonical SMILES of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The canonical SMILES is CSCCC(C(=O)[O-])NC(=O)CCC(=O)[O-].[Na+].[Na+].
What is the CAS number of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The CAS number is 93805-88-0.
What is the hydrogen bond donor count of Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate?
The hydrogen bond donor count is 1.
Is Disodium N-(3-carboxylato-1-oxopropyl)-dl-methionate a Canonicalized compound?
Yes, it is a canonicalized compound.