What is the molecular formula of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The molecular formula is C9H13CaNO5S.
What are the synonyms of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The synonyms are EINECS 298-572-1 and 93805-87-9.
What is the molecular weight of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The molecular weight is 287.35 g/mol.
What is the IUPAC name of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The IUPAC name is calcium;2-(3-carboxylatopropanoylamino)-4-methylsulfanylbutanoate.
What is the InChI of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The InChI is InChI=1S/C9H15NO5S.Ca/c1-16-5-4-6(9(14)15)10-7(11)2-3-8(12)13;/h6H,2-5H2,1H3,(H,10,11)(H,12,13)(H,14,15);/q;+2/p-2.
What is the InChIKey of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The InChIKey is PTINZVAKLQSFJY-UHFFFAOYSA-L.
What is the canonical SMILES of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The canonical SMILES is CSCCC(C(=O)[O-])NC(=O)CCC(=O)[O-].[Ca+2].
What is the CAS number of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The CAS number is 93805-87-9.
What is the European Community (EC) Number of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The EC Number is 298-572-1.
What is the formal charge of Calcium N-(3-carboxylato-1-oxopropyl)-DL-methionate?
The formal charge is 0.