93804-71-8 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C14H17NO4.
The synonyms of the compound are 938047-66-6 acetamide,n-hydroxy-n-[1-(5-methoxy-2-methyl-3-benzofuranyl)ethyl]- and acetamide,n-hydroxy-n-[1-(5-methoxy-2-methyl-3-benzo[b]furanyl)ethyl]-.
The computed IUPAC name of the compound is N-hydroxy-N-[1-(5-methoxy-2-methyl-1-benzofuran-3-yl)ethyl]acetamide.
The InChI of the compound is InChI=1S/C14H17NO4/c1-8(15(17)10(3)16)14-9(2)19-13-6-5-11(18-4)7-12(13)14/h5-8,17H,1-4H3.
The InChIKey of the compound is GOCCIECGJNXUOR-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=C(C2=C(O1)C=CC(=C2)OC)C(C)N(C(=O)C)O.
The molecular weight of the compound is 263.29 g/mol.
The XLogP3-AA value of the compound is 1.9.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.