What is the molecular formula of Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
The molecular formula is C11H22ClNO2.
What are some synonyms for Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
Some synonyms include DIETHYLMETHYL[2-[(1-OXOALLYL)OXY]PROPYL]AMMONIUM CHLORIDE and Diethylmethyl(2-((1-oxoallyl)oxy)propyl)ammonium chloride.
What is the molecular weight of Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
The molecular weight is 235.75 g/mol.
What is the IUPAC name of Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
The IUPAC name is diethyl-methyl-(2-prop-2-enoyloxypropyl)azanium;chloride.
What is the InChIKey of Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
The InChIKey is NNLKRJIEZYOPNY-UHFFFAOYSA-M.
What is the canonical SMILES representation of Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
The canonical SMILES representation is CC[N+](C)(CC)CC(C)OC(=O)C=C.[Cl-].
What is the CAS number for Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride?
The CAS number is 93804-77-4.
How many hydrogen bond acceptor counts does Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does Diethylmethyl[2-[(1-oxoallyl)oxy]propyl]ammonium chloride have?
It has 7 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.