93804-59-2 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C13H22O.
The IUPAC name of the compound is (8,8-dimethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl)methanol.
The InChI of the compound is InChI=1S/C13H22O/c1-13(2)7-3-4-11-6-5-10(9-14)8-12(11)13/h6,10,12,14H,3-5,7-9H2,1-2H3.
The InChIKey of the compound is NBXUINSCGNNOCY-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1(CCCC2=CCC(CC21)CO)C.
The molecular weight of the compound is 194.31 g/mol.
The compound has 1 hydrogen bond donor count.
The compound has 1 hydrogen bond acceptor count.
The XLogP3-AA value of the compound is 3.
Yes, the compound is canonicalized.