938443-19-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12O2.
The molecular weight of the compound is 164.20 g/mol.
The IUPAC name of the compound is 1-(2-hydroxy-5-methylphenyl)propan-1-one.
The InChI of the compound is InChI=1S/C10H12O2/c1-3-9(11)8-6-7(2)4-5-10(8)12/h4-6,12H,3H2,1-2H3.
The InChIKey of the compound is CXZJBPYDVCLMFX-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCC(=O)C1=C(C=CC(=C1)C)O.
The CAS number of the compound is 938-45-4.
The EC number of the compound is 213-342-2.
The XLogP3 value of the compound is 2.9.
Yes, the compound is canonicalized.