93783-11-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H10ClNO3.
The molecular weight of the compound is 179.60 g/mol.
The IUPAC name of the compound is 2-[(2-chloroacetyl)amino]ethyl acetate.
The InChI of the compound is InChI=1S/C6H10ClNO3/c1-5(9)11-3-2-8-6(10)4-7/h2-4H2,1H3,(H,8,10).
The InChIKey of the compound is VQBLXJYMFADQHI-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC(=O)OCCNC(=O)CCl.
There is 1 hydrogen bond donor count in the compound.
There are 3 hydrogen bond acceptor counts in the compound.
There are 5 rotatable bond counts in the compound.
Yes, the compound is canonicalized.