93777-49-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C8H13NO5S.
The molecular weight is 235.26 g/mol.
The component compounds are CID 124993 (2,4-Dihydroxybenzylamine) and CID 6395 (Methanesulfonic Acid).
It was created on 2005-08-08.
The IUPAC name is (2,4-dihydroxyphenyl)methylazanium;methanesulfonate.
The InChI is InChI=1S/C7H9NO2.CH4O3S/c8-4-5-1-2-6(9)3-7(5)10;1-5(2,3)4/h1-3,9-10H,4,8H2;1H3,(H,2,3,4).
The Canonical SMILES is CS(=O)(=O)[O-].C1=CC(=C(C=C1O)O)C[NH3+].
The CAS number is 93777-56-1.
The hydrogen bond donor count is 3.
Yes, it has a covalently-bonded unit count of 2.