937642-41-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H14N2O.
Some synonyms of the compound include 937647-97-7 and 5-(METHYLAMINO)METHYL-8-METHOXYQUINOLINE.
The compound was created in 2007-07-31 and last modified on 2023-12-30.
The InChI of the compound is InChI=1S/C12H14N2O/c1-13-8-9-5-6-11(15-2)12-10(9)4-3-7-14-12/h3-7,13H,8H2,1-2H3.
The XLogP3-AA value of the compound is 1.5.
The compound has 1 hydrogen bond donor count.
The exact mass of the compound is 202.110613074 g/mol.
The compound has 15 heavy atoms.
Yes, the compound is canonicalized.
The topological polar surface area of the compound is 34.2 Ų.