937-19-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C20H27NOSi.
The molecular weight of the compound is 325.5 g/mol.
The IUPAC name of the compound is tert-butyl-diphenyl-[(3S)-pyrrolidin-3-yl]oxysilane.
The InChI of the compound is InChI=1S/C20H27NOSi/c1-20(2,3)23(18-10-6-4-7-11-18,19-12-8-5-9-13-19)22-17-14-15-21-16-17/h4-13,17,21H,14-16H2,1-3H3/t17-/m0/s1.
The InChIKey of the compound is WZTJJHSTQOTADQ-KRWDZBQOSA-N.
The canonical SMILES of the compound is CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC3CCNC3.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 5 rotatable bond counts.
The topological polar surface area of the compound is 21.3 ?^2.