What is the molecular formula of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The molecular formula is C12H16ClNO3.
What is the molecular weight of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The molecular weight is 257.71 g/mol.
What is the IUPAC name of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The IUPAC name is tert-butyl N-(4-chloro-2-methoxyphenyl)carbamate.
What is the InChI of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The InChI is InChI=1S/C12H16ClNO3/c1-12(2,3)17-11(15)14-9-6-5-8(13)7-10(9)16-4/h5-7H,1-4H3,(H,14,15).
What is the InChIKey of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The InChIKey is HMZLLBSZIVWLTD-UHFFFAOYSA-N.
What is the Canonical SMILES of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The Canonical SMILES is CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Cl)OC.
How many hydrogen bond donor counts does tert-Butyl 4-chloro-2-methoxyphenylcarbamate have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does tert-Butyl 4-chloro-2-methoxyphenylcarbamate have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of tert-Butyl 4-chloro-2-methoxyphenylcarbamate?
The topological polar surface area is 47.6 Å2.
Is tert-Butyl 4-chloro-2-methoxyphenylcarbamate a canonicalized compound?
Yes, it is a canonicalized compound.