936940-66-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H15N3.
The molecular weight of the compound is 153.22 g/mol.
The IUPAC name of the compound is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine.
The InChI of the compound is InChI=1S/C8H15N3/c1-6-8(4-3-5-9)7(2)11-10-6/h3-5,9H2,1-2H3,(H,10,11).
The InChIKey of the compound is LCGYDKLNJOBMBD-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC1=C(C(=NN1)C)CCCN.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 54.7 Å2.
Yes, the compound is canonicalized.