936940-58-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-methyl-4-pyrrolidin-2-yl-1,2,5-oxadiazole.
The molecular formula of the compound is C7H11N3O.
The molecular weight of the compound is 153.18 g/mol.
The InChI of the compound is InChI=1S/C7H11N3O/c1-5-7(10-11-9-5)6-3-2-4-8-6/h6,8H,2-4H2,1H3.
The InChIKey of the compound is DIYORNGAPDTTKE-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=NON=C1C2CCCN2.
The CAS number of the compound is 936940-68-0.
The XLogP3-AA value of the compound is 0.1.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.