936940-46-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 670408.
The molecular formula of the compound is C10H11N3.
The molecular weight of the compound is 173.21 g/mol.
The IUPAC name of the compound is (5-phenyl-1H-pyrazol-4-yl)methanamine.
The InChI of the compound is InChI=1S/C10H11N3/c11-6-9-7-12-13-10(9)8-4-2-1-3-5-8/h1-5,7H,6,11H2,(H,12,13).
The InChIKey of the compound is YTYBRZWDGVSNPC-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC=C(C=C1)C2=C(C=NN2)CN.
The CAS number of the compound is 936940-58-8.
The XLogP3-AA value of the compound is 0.7.
Yes, the compound is canonicalized.