936125-96-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H7ClN2O2.
The IUPAC name of the compound is 3-(6-chloropyrazin-2-yl)benzoic acid.
The molecular weight of the compound is 234.64 g/mol.
The InChI of the compound is InChI=1S/C11H7ClN2O2/c12-10-6-13-5-9(14-10)7-2-1-3-8(4-7)11(15)16/h1-6H,(H,15,16).
The InChIKey of the compound is DLXPGGIBZPMKHR-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC(=C1)C(=O)O)C2=CN=CC(=N2)Cl.
The CAS number of the compound is 936138-14-6.
The XLogP3-AA value of the compound is 1.9.
The compound has 1 hydrogen bond donor count.
The compound has 2 rotatable bond counts.