CAS
935460-27-8 Purity
---
935460-27-8 Purity
---
Inquiry Basket
1-[3-(1,4-Dioxan-2-yl)phenyl]-cyclopropanamine
CAS
935460-70-1
Catalog Number
ACM935460701
Category
Other Products
Molecular Formula
C13H17NO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
Cyclopropanamine, 1-[3-(1,4-dioxan-2-yl)phenyl]-
What is the molecular formula of the compound?
The molecular formula of the compound is C13H17NO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 219.28 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-[3-(1,4-dioxan-2-yl)phenyl]cyclopropan-1-amine.
What is the InChIKey of the compound?
The InChIKey of the compound is PSMQNLQRQYXXMY-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CC1(C2=CC=CC(=C2)C3COCCO3)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.4.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Cyclopropanamine, 1-[3-(tetrahydro-3-furanyl)phenyl]-](https://resource.alfa-chemistry.com/structure/935460-27-8.gif)
![Cyclopropanamine,1-[3-(tetrahydro-2-furanyl)phenyl]-](https://resource.alfa-chemistry.com/structure/935460-30-3.gif)
![Cyclopropanamine, 1-[3-(4-morpholinyl)phenyl]-](https://resource.alfa-chemistry.com/structure/935460-59-6.gif)
![3-Chloro-1H-pyrazolo[4,3-c]pyridine-7-carbaldehyde](https://resource.alfa-chemistry.com/structure/93546-17-9.gif)
![(1r*,2r*,5r*)-(7-Oxo-6-oxa-bicyclo[3.2.1]oct-2-yl)-carbamic acid benzyl ester](https://resource.alfa-chemistry.com/structure/935470-08-9.gif)
CAS
935470-08-9 Purity
---
935470-08-9 Purity
---
