934-85-0 Purity
98 atom % D
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H15NO2.
The molecular weight of the compound is 181.23 g/mol.
The IUPAC name of the compound is (4-ethoxy-3-methoxyphenyl)methanamine.
The InChI of the compound is InChI=1S/C10H15NO2/c1-3-13-9-5-4-8(7-11)6-10(9)12-2/h4-6H,3,7,11H2,1-2H3.
The InChIKey of the compound is LMUGJOISPLJRRD-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC1=C(C=C(C=C1)CN)OC.
The CAS number of the compound is 93489-14-6.
The XLogP3 value of the compound is 0.7.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor count.