What is the molecular formula of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The molecular formula is C17H24ClNO4.
What is the molecular weight of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The molecular weight is 341.8 g/mol.
When was 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester created?
It was created on March 6, 2014.
What is the IUPAC name of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The IUPAC name is diethyl 1-benzylpyrrolidine-2,5-dicarboxylate;hydrochloride.
What is the InChI of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The InChI is InChI=1S/C17H23NO4.ClH/c1-3-21-16(19)14-10-11-15(17(20)22-4-2)18(14)12-13-8-6-5-7-9-13;/h5-9,14-15H,3-4,10-12H2,1-2H3;1H.
What is the Canonical SMILES of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The Canonical SMILES is CCOC(=O)C1CCC(N1CC2=CC=CC=C2)C(=O)OCC.Cl.
What is the hydrogen bond donor count of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The hydrogen bond acceptor count is 5.
What is the topological polar surface area of 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester?
The topological polar surface area is 55.8 ?2.
Is 1-Benzylpyrrolidine-2,5-dicarboxylic acid diethyl ester a canonicalized compound?
Yes, it is a canonicalized compound.