CAS
934-67-8 Purity
96%
934-67-8 Purity
96%
Inquiry Basket
Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate
CAS
934690-74-1
Catalog Number
ACM934690741
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
The molecular formula is C16H15NO7.
When was Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate created?
It was created on September 25, 2009.
What is the computed IUPAC name of Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
The computed IUPAC name is methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate.
What is the Canonical SMILES representation of Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
The Canonical SMILES is COC1=C(C=C(C=C1)OC2=C(C=C(C=C2)C(=O)OC)[N+](=O)[O-])OC.
How is the XLogP3-AA value computed?
The XLogP3-AA value is computed by XLogP3 3.0.
How many hydrogen bond acceptors are there in Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
There are 7 hydrogen bond acceptors.
What is the exact mass of Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
The exact mass is 333.08485182 g/mol.
What is the topological polar surface area of Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
The topological polar surface area is 99.8 Ų.
How many heavy atoms are present in Methyl 4-(3,4-dimethoxyphenoxy)-3-nitrobenzoate?
There are 24 heavy atoms.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![[1,1'-Biphenyl]-2-carboxaldehyde,4-methoxy-](https://resource.alfa-chemistry.com/structure/934691-48-2.gif)
