CAS
933-98-2 Purity
---
933-98-2 Purity
---
Inquiry Basket
2-(3-Fluorophenyl)pyrimidine-5-carboxylic acid
CAS
933988-24-0
Catalog Number
ACM933988240
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
2-(3-Fluorophenyl)pyrimidine-5-carboxylic acid
What is the molecular formula of the compound?
The molecular formula of the compound is C11H7FN2O2.
When was the compound created and last modified?
The compound was created on 2010-03-29 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(3-fluorophenyl)pyrimidine-5-carboxylic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 218.18 g/mol.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC(=CC(=C1)F)C2=NC=C(C=N2)C(=O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 63.1 Ų.
Does the compound have any defined bond stereocenter count?
No, the compound does not have any defined bond stereocenter count.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.5.
Is the compound's Covalently-Bonded Unit Count canonicalized?
Yes, the compound's Covalently-Bonded Unit Count is canonicalized.
Recommended Products
