CAS
933761-00-3 Purity
96%
933761-00-3 Purity
96%
Inquiry Basket
3,5-Hexadien-2-one,3-hydroxy-(9ci)
CAS
93376-49-9
Catalog Number
ACM93376499
Category
Other Products
Molecular Weight
112.13
Molecular Formula
C6H8O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is (3Z)-3-hydroxyhexa-3,5-dien-2-one.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H8O2/c1-3-4-6(8)5(2)7/h3-4,8H,1H2,2H3/b6-4-.
What is the InChIKey of the compound?
The InChIKey of the compound is GWTAAMLIAPZWCQ-XQRVVYSFSA-N.
What is the molecular weight of the compound?
The molecular weight of the compound is 112.13 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
What is the exact mass of the compound?
The exact mass of the compound is 112.052429494 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
