933710-66-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H9N3.
The molecular weight of the compound is 123.16 g/mol.
The IUPAC name of the compound is 2-(1H-imidazol-2-yl)cyclopropan-1-amine.
The InChI of the compound is InChI=1S/C6H9N3/c7-5-3-4(5)6-8-1-2-9-6/h1-2,4-5H,3,7H2,(H,8,9).
The InChIKey of the compound is SYDXEJRVCYPNDT-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1C(C1N)C2=NC=CN2.
The XLogP3-AA value of the compound is -0.6.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.