933690-30-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H8N2O.
The molecular weight of the compound is 160.17 g/mol.
The IUPAC name of the compound is 2-methyl-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde.
The InChI key of the compound is SWSUONHHMXXYNL-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is CC1=C(C2=C(N1)C=NC=C2)C=O.
The CAS number of the compound is 933691-82-8.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 45.8 Å^2.
Yes, the compound is canonicalized.